Pentosidine TFA | MedChemExpress (MCE)
Pentosidine TFA is a fluorescent advanced glycation end product (AGE) and crosslink. Pentosidine can serve as a biomarker for non-enzymatic modification of long-lived proteins by the Maillard reaction, providing insight into the overall role of the Maillard reaction in aging and disease[1].

Trivial name | Pentosidine TFA |
Catalog Number | HY-113033A |
Research Area | Neurological Disease |
CAS# | 225784-09-8 |
Purity | ≥98.0% |
SMILES | OC(C(F)(F)F)=O.OC([C@@H](N)CCCCN1C2=NC(NCCC[C@H](N)C(O)=O)=NC2=CC=C1)=O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/pentosidine-tfa.html |