FKBP51-Hsp90-IN-2 | MedChemExpress (MCE)
FKBP51-Hsp90-IN-2 (Compound E08) is a selective FKBP51–Hsp90 protein-protein interaction inhibitor with IC50 values of 0.4 µM and 5 µM for FKBP51 and FKBP52, respectively. FKBP51-Hsp90-IN-2 also effectively stimulates cellular energy metabolism and neurite growth. FKBP51-Hsp90-IN-2 can be used in research on neurodegenerative diseases and cancer[1].
| Trivial name | FKBP51-Hsp90-IN-2 |
| Catalog Number | HY-158131 |
| Research Area | Neurological Disease; Cancer |
| CAS# | 601511-07-3 |
| Purity | ≥98.0% |
| SMILES | CCC(NC1=C(C=C(C=C1)NC(CSC2=NC3=CC4=C(C=C3C=C2C)CCC4)=O)C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/fkbp51-hsp90-in-2.html |