AIE-GA | MedChemExpress (MCE)
AIE-GA is a Golgi apparatus (GA) fluorescent probe (green channel: λex = 405 nm, λem = 500-700 nm). AIE-GA has a favourable binding ability to interact with COX-2. AIE-GA binds to the cyclooxygenase catalytic site of COX-2[1].

Trivial name | AIE-GA |
Catalog Number | HY-D2297 |
Research Area | Others |
CAS# | 2653341-16-1 |
Purity | ≥98.0% |
SMILES | N#C/C(C1=CC=C(C2=CC=C(S(N)(=O)=O)C=C2)C=C1)=C\C3=CC=C(N(C4=CC=CC=C4)C5=CC=CC=C5)C=C3 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/aie-ga.html |