SGR-1505 | MedChemExpress (MCE)
SGR-1505 is an orally active MALT1 allosteric inhibitor. SGR-1505 inhibits MALT1 enzymatic activity and shows anti-proliferative activity in BTK inhibitor (BTKi)-sensitive and BTKi-resistant activated B cell-like diffuse large B cell lymphoma (ABC-DLBCL) cell lines. SGR-1505 can be used for research of B-cell lymphomas[1].
| Trivial name | SGR-1505 |
| Catalog Number | HY-160698 |
| Research Area | Cancer |
| CAS# | 2661481-41-8 |
| Purity | ≥98.0% |
| SMILES | FC(F)([C@]1(C2=C(C=NC3=CC(F)=NN32)N(C1)C(NC4=CN=C(N5N=CC=N5)C(Cl)=C4)=O)C)F |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/sgr-1505.html |