6,9,12,15,18-Heneicosapentaenoic acid | MedChemExpress (MCE)
6,9,12,15,18-Heneicosapentaenoic acid (HPA; Heneicosapentaenoic acid methyl ester) inhibits the conversion of α-linoleic acid into Arachidonic acid (HY-109590) in hepatoma cells, the activation of prostaglandin H synthase and thromboxane synthesis in isolated platelets. 6,9,12,15,18-Heneicosapentaenoic acid is weak inducer of acyl-CoA oxidase in hepatoma cells[1].
| Trivial name | 6,9,12,15,18-Heneicosapentaenoic acid |
| Catalog Number | HY-141469 |
| Alternative Name(s) | HPA; Heneicosapentaenoic acid methyl ester |
| Research Area | Neurological Disease; Cardiovascular Disease |
| CAS# | 65919-53-1 |
| Purity | ≥98.0% |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC(OC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/6-9-12-15-18-heneicosapentaenoic-acid.html |