Antifungal agent 96 | MedChemExpress (MCE)
Antifungal agent 96 (Compound WZ-2) is an antifungal agent with good blood-brain barrier permeability and brain penetration. Antifungal agent 96 inhibits the growth of C. neoformans H99 and C. albicans 0304103 with MIC values of 0.016 and 32 μg/mL, respectively[1].
| Trivial name | Antifungal agent 96 |
| Catalog Number | HY-161380 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | O=C(C1=C(/C2=N/OC)C=CS1)C3=C2ON=C3C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/antifungal-agent-96.html |