RO-275 | MedChemExpress (MCE)
RO-275 (compound 29) is a potent, selective and orally active HCN1 inhibitor with IC50 values of 0.046, 14.3, 4.6, 13.9 µM for HCN1, HCN2, HCN3, HCN4, respectively. RO-275 rescues decremented working memory. RO-275 has the potential for the research of cognitive dysfunction in brain disorder[1][2].
| Trivial name | RO-275 |
| Catalog Number | HY-160505 |
| Research Area | Neurological Disease |
| CAS# | 2648837-04-9 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=NC(C#CC2=C(C)C(Cl)=NC=C2)=C(C)N1C3=CC=CN=C3)N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ro-275.html |