BRD4-IN-5 | MedChemExpress (MCE)
BRD4-IN-5 (example 51) is a BRD4 inhibitor. The Ki values of the two BRD4 domains BDI_K57-E168 and BDII_E352-M457 are 9.7 nM and 16.1 nM, respectively. BRD4-IN-5 can be used in cancer research[1].
| Trivial name | BRD4-IN-5 |
| Catalog Number | HY-160662 |
| Research Area | Cancer |
| CAS# | 1445993-41-8 |
| Purity | ≥98.0% |
| SMILES | CN1C=C(C2=C(OC3=C(F)C=C(F)C=C3)C=CC(C(NC4CCOC4)=O)=C2)C5=C(NC=C5)C1=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/brd4-in-5.html |