Leukotriene B4 ethanolamide | MedChemExpress (MCE)
Leukotriene B4 ethanolamide (LTB4 ethanolamide) is an antagonist and a partial agonist for Leukotriene B4 (LTB4) receptor 1 (BLTR1). Leukotriene B4 ethanolamide ameliorates the tumor progression, which is only asscociated with inflammation[1][2].
| Trivial name | Leukotriene B4 ethanolamide |
| Catalog Number | HY-131651 |
| Alternative Name(s) | LTB4 ethanolamide |
| Research Area | Cancer |
| CAS# | 877459-63-7 |
| Purity | ≥98.0% |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(NCCO)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/leukotriene-b4-ethanolamide.html |