N-Acetyl-Leukotriene E4 | MedChemExpress (MCE)
N-Acetyl-Leukotriene E4 (N-Acetyl-LTE4) is a metabolite of Leukotriene E4 (LTE4) (HY-113465), which is detected in bile and urine[1]. N-Acetyl-Leukotriene E4 produces a vasoconstriction in the mesenteric vessels which led to reduction of blood flow to the gut[2].
| Trivial name | N-Acetyl-Leukotriene E4 |
| Catalog Number | HY-131395 |
| Alternative Name(s) | N-Acetyl-LTE4 |
| Research Area | Cardiovascular Disease |
| CAS# | 80115-95-3 |
| Purity | ≥98.0% |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](NC(C)=O)C(O)=O)[C@@H](O)CCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n-acetyl-leukotriene-e4.html |