12-Oxo-leukotriene B4 | MedChemExpress (MCE)
12-Oxo-leukotriene B4 (12-Oxo-LTB4) is an intermediate in the lipoxygenase-catalyzed path of Arachidonic acid (HY-109590) metabolism. 12-Oxo-leukotriene B4 is crucial in Leukotriene B4 metabolism and is involved in inflammation reactions[1]. 12-Oxo-leukotriene B4 stimulates calcium levels in human neutrophils with an EC50 of 33 nM. 12-Oxo-leukotriene B4 induces migration of neutrophils with EC50 of 170 nM[2].
| Trivial name | 12-Oxo-leukotriene B4 |
| Catalog Number | HY-130497 |
| Alternative Name(s) | 12-Oxo-LTB4 |
| Research Area | Inflammation/Immunology |
| CAS# | 136696-10-1 |
| Purity | ≥98.0% |
| SMILES | CCCCC/C=C\CC(/C=C/C=C/C=C\[C@@H](O)CCCC(O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/12-oxo-leukotriene-b4.html |