Prostaglandin F2α dimethyl amine | MedChemExpress (MCE)
Prostaglandin F2α dimethyl amine is a Prostaglandin F2α (HY-12956) derivative. Prostaglandin F2α dimethyl amine is an antagonist for Prostaglandin F receptor (FP)[1]. Prostaglandin F2α dimethyl amine blocks the cardiovascular responses induced by orexin and Arachidonic acid (HY-109590)[2].
| Trivial name | Prostaglandin F2α dimethyl amine |
| Catalog Number | HY-114761 |
| Research Area | Cardiovascular Disease |
| CAS# | 67508-09-2 |
| Purity | ≥98.0% |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]([C@H](C[C@H]1O)O)C/C=C\CCCCN(C)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/prostaglandin-f2α-dimethyl-amine.html |
