PGF2α-isopropyl ester | MedChemExpress (MCE)
PGF2α-isopropyl ester is a Prostaglandin F2α (HY-12956) derivative, which is active in lowering the intraocular pressure (IOP) through increased uveoscleral outflow of aqueous humor. PGF2α-isopropyl ester causes side effects of conjunctival hyperemia and ocular irritation[1].
| Trivial name | PGF2α-isopropyl ester |
| Catalog Number | HY-106037 |
| Research Area | Others |
| CAS# | 53764-90-2 |
| Purity | ≥98.0% |
| SMILES | CC(C)OC(CCC/C=C\C[C@@H]1[C@H]([C@@H](C[C@@H]1O)O)/C=C/[C@@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pgf2α-isopropyl-ester.html |