RU 59063 | MedChemExpress (MCE)
RU 59063 is an N-substituted arylthiohydantoin compound with antiandrogenic activity and high relative binding affinity for the rat androgen receptor. RU 59063 is a nonsteroidal androgen receptor that functions as a radioactive AR radioprobe (Ki: 0.71 nM, rAR) when its trifluoromethyl group is replaced by a similar hydrophobic iodine atom[1][2].
| Trivial name | RU 59063 |
| Catalog Number | HY-117953 |
| Research Area | Endocrinology |
| CAS# | 155180-53-3 |
| Purity | ≥98.0% |
| SMILES | N#CC1=CC=C(C=C1C(F)(F)F)N(C2=O)C(N(C2(C)C)CCCCO)=S |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ru-59063.html |