ORIC-533 | MedChemExpress (MCE)
ORIC-533 is an orally active, selective CD73 inhibitor with AMP-competition. ORIC-533 restores immunosuppressed CD8+ T cell proliferation and activation, triggers significant lysis and cell death of multiple myeloma cells in the bone marrow microenvironment[1].
| Trivial name | ORIC-533 |
| Catalog Number | HY-160696 |
| Research Area | Cancer |
| CAS# | 2641306-62-7 |
| Purity | ≥98.0% |
| SMILES | O[C@H]1[C@@H](O)[C@H](N2C3=NC(Cl)=NC(NC4CCCC4)=C3C=N2)O[C@@H]1CO[C@](P(O)(O)=O)(CO)COCC5=NN=NN5 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/oric-533.html |