Harzianopyridone | MedChemExpress (MCE)
Harzianopyridone is a compound that can be isolated from Trichoderma harzianum. Harzianopyridone is a succinate dehydrogenase (SDH) inhibitor with an IC50 of 80 nM. Harzianopyridone has antifungal, antibacterial, and herbicidal activities[1].
| Trivial name | Harzianopyridone |
| Catalog Number | HY-120183 |
| Research Area | Infection |
| CAS# | 137813-88-8 |
| Purity | ≥98.0% |
| SMILES | O=C1NC(OC)=C(C(O)=C1C([C@H](C/C=C/C)C)=O)OC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/harzianopyridone.html |