AIE-ER | MedChemExpress (MCE)
AIE-ER is a specific endoplasmic reticulum (ER) fluorescent probe (green channel: λex=405 nm, λem=450~650 nm) that exhibits remarkable photostability, high brightness, and low working concentration. AIE-ER may provide an avenue for studying diseases related to the endoplasmic reticulum[1].
| Trivial name | AIE-ER |
| Catalog Number | HY-D2299 |
| Research Area | Metabolic Disease; Cancer |
| CAS# | 2653341-17-2 |
| Purity | ≥98.0% |
| SMILES | N#C/C(C1=CC=C(C2=CC=C(S(NC(NC3CCCCC3)=O)(=O)=O)C=C2)C=C1)=C\C4=CC=C(N(C5=CC=CC=C5)C6=CC=CC=C6)C=C4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/aie-er.html |