RORγ allosteric probe-1 | MedChemExpress (MCE)
RORγ allosteric probe-1 (Compound 12h) is a RORγ allosteric fluorescent probe (Ex/Em: 490/524 nm). RORγ allosteric probe-1 can be used for exploration of RORγ allosteric inhibitors and RORγ function[1].
| Trivial name | RORγ allosteric probe-1 |
| Catalog Number | HY-D2293 |
| Research Area | Others |
| CAS# | 2983890-50-0 |
| Purity | ≥98.0% |
| SMILES | ClC1=CC=CC(C(F)(F)F)=C1C(N(C2=C3C=CC(C(NCCOCCOCCNC(NC4=CC(C(OC56C7=C(OC8=CC(O)=CC=C86)C=C(C=C7)O)=O)=C5C=C4)=S)=O)=C2)N=C3C9=CC=C(C=C9)C(O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/rorγ-allosteric-probe-1.html |