Prostaglandin E3 | MedChemExpress (MCE)
Prostaglandin E3 is an eicosanoid derived from eicosapentaenoic acid. Prostaglandin E3 inhibits polarization towards M1 but promotes polarization of M2a macrophages. Prostaglandin E3 shows anti-inflammatory and anti-tumor activity[1].
| Trivial name | Prostaglandin E3 |
| Catalog Number | HY-113481 |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 802-31-3 |
| Purity | ≥98.0% |
| SMILES | CC/C=C\C[C@H](O)/C=C/[C@@H]1[C@H](C(C[C@H]1O)=O)C/C=C\CCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/prostaglandin-e3.html |