(E/Z)-MCB-613 | MedChemExpress (MCE)
(E/Z)-MCB-613 is a pan-Steroid Receptor Coactivator (SRC) stimulator. (E/Z)-MCB-613 overstimulates SRC activity in cancer cells resulting in excessive generation of reactive oxygen species (ROS), leading to cell stress and death by a process called paraptosis. (E/Z)-MCB-613 is a cytotoxic molecule that plays an important role in cancer[1].

Trivial name | (E/Z)-MCB-613 |
Catalog Number | HY-19625A |
Research Area | Cancer |
CAS# | 296792-62-6 |
Purity | ≥98.0% |
SMILES | O=C1/C(CC(CC)C/C1=C\C2=CC=CN=C2)=C/C3=CC=CN=C3 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/e-z-mcb-613.html |