17-Phenyl-ω-trinor-PGE2 | MedChemExpress (MCE)
17-Phenyl-ω-trinor-PGE2 is a PGE2 (HY-101952) analog, which is an agonist for EP1 and EP3 receptor. 17-Phenyl-ω-trinor-PGE2 inhibits the PAF-induced aggregation of human platelet-rich plasma (PRP) and Cicaprost (HY-19583) induced Cyclic AMP (HY-B1511) production[1].
| Trivial name | 17-Phenyl-ω-trinor-PGE2 |
| Catalog Number | HY-128039 |
| Research Area | Others |
| CAS# | 38315-43-4 |
| Purity | ≥98.0% |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)CCC2=CC=CC=C2)[C@H](O)CC1=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/17-phenyl-ω-trinor-pge2.html |