6β,19-Dihydroxyurs-12-en-3-oxo-28-oic acid | MedChemExpress (MCE)
6β,19-Dihydroxyurs-12-en-3-oxo-28-oic acid (Compound 14) is an osteoclast inhibitor with anti-osteoclastogenic activity. 6β,19-Dihydroxyurs-12-en-3-oxo-28-oic acid can be obtained from Eriobotrya japonica leaves. 6β,19-Dihydroxyurs-12-en-3-oxo-28-oic acid can be used in osteoporosis research[1].
| Trivial name | 6β,19-Dihydroxyurs-12-en-3-oxo-28-oic acid |
| Catalog Number | HY-N9199 |
| Research Area | Others |
| CAS# | 194027-11-7 |
| Purity | ≥98.0% |
| SMILES | C[C@@]12C([C@@]3([H])[C@@](CC2)(CC[C@H]([C@]3(O)C)C)C(O)=O)=CC[C@@]4([H])[C@]1(C[C@@H]([C@]5([H])[C@@]4(CCC(C5(C)C)=O)C)O)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/6β-19-dihydroxyurs-12-en-3-oxo-28-oic-acid.html |