MitoB bromide | MedChemExpress (MCE)
MitoB bromide is an exomarker of mitochondrial hydrogen peroxide. MitoB bromide is a mitochondria-targeted ratiometric probe, and can be used to measure levels of one major ROS, hydrogen peroxide, within living animals[1][2].
| Trivial name | MitoB bromide |
| Catalog Number | HY-126474 |
| Research Area | Inflammation/Immunology |
| CAS# | 1247025-84-8 |
| Purity | ≥98.0% |
| SMILES | OB(C1=CC=CC(C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)=C1)O.[Br-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mitob-bromide.html |