DL-Tartaric acid (Standard) | MedChemExpress (MCE)
DL-Tartaric acid (Standard) is the analytical standard of DL-Tartaric acid. This product is intended for research and analytical applications. DL-Tartaric acid is a non-racemic mixture of L- and D-tartaric acids with antioxidant activities[1][2].
| Trivial name | DL-Tartaric acid (Standard) |
| Catalog Number | HY-Y1315R |
| Research Area | Others |
| CAS# | 133-37-9 |
| Purity | ≥98.0% |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dl-tartaric-acid-standard.html |