5-Hydroxyindole-3-acetic acid (Standard) | MedChemExpress (MCE)
5-Hydroxyindole-3-acetic acid (Standard) is the analytical standard of 5-Hydroxyindole-3-acetic acid. This product is intended for research and analytical applications. 5-Hydroxyindole-3-acetic acid is the main metabolite of serotonin or metanephrines, which can be used as a biomarker of neuroendocrine tumors.
| Trivial name | 5-Hydroxyindole-3-acetic acid (Standard) |
| Catalog Number | HY-W008253R |
| Research Area | Neurological Disease; Cancer |
| CAS# | 54-16-0 |
| Purity | ≥98.0% |
| SMILES | O=C(O)CC1=CNC2=C1C=C(O)C=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/5-hydroxyindole-3-acetic-acid-standard.html |