Cefazolin sodium (Standard) | MedChemExpress (MCE)
Cefazolin (sodium) (Standard) is the analytical standard of Cefazolin (sodium). This product is intended for research and analytical applications. Cefazolin sodium is a first-generation cephalosporin antibiotic and can be used in varieties of bacterial infections research[1]. Cefazolin sodium has anti-inflammatory effect and can attenuate post-operative cognitive dysfunction (POCD)[2].
| Trivial name | Cefazolin sodium (Standard) |
| Catalog Number | HY-B1078R |
| Alternative Name(s) | Cephazolin sodium (Standard) |
| Research Area | Neurological Disease; Inflammation/Immunology; Infection |
| CAS# | 27164-46-1 |
| Purity | ≥98.0% |
| SMILES | O=C(C(N12)=C(CSC3=NN=C(C)S3)CS[C@]2([H])[C@H](NC(CN4N=NN=C4)=O)C1=O)O[Na] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cefazolin-sodium-standard.html |