Amoxapine (Standard) | MedChemExpress (MCE)
Amoxapine (Standard) is the analytical standard of Amoxapine. This product is intended for research and analytical applications. Amoxapine is a tetracyclic antidepressant of the dibenzoxazepine family, although it is generally classified as a secondary amine tricyclic antidepressant.
| Trivial name | Amoxapine (Standard) |
| Catalog Number | HY-B0991R |
| Alternative Name(s) | CL-67772 (Standard) |
| Research Area | Neurological Disease |
| CAS# | 14028-44-5 |
| Purity | ≥98.0% |
| SMILES | ClC1=CC=C(OC2=CC=CC=C2N=C3N4CCNCC4)C3=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/amoxapine-standard.html |