Dioxybenzone (Standard) | MedChemExpress (MCE)
Dioxybenzone (Standard) is the analytical standard of Dioxybenzone. This product is intended for research and analytical applications. Dioxybenzone is an organic compound used to block UVB and short-wave UVA (ultraviolet) radiation.
| Trivial name | Dioxybenzone (Standard) |
| Catalog Number | HY-B0966R |
| Alternative Name(s) | Benzophenone-8 (Standard); UV-24 (Standard) |
| Research Area | Others |
| CAS# | 131-53-3 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC=C(OC)C=C1O)C2=CC=CC=C2O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dioxybenzone-standard.html |