Benzethonium chloride (Standard) | MedChemExpress (MCE)
Benzethonium (chloride) (Standard) is the analytical standard of Benzethonium (chloride). This product is intended for research and analytical applications. Benzethonium chloride inhibits nicotinic acetylcholine receptors in human recombinant α7 and α4β2 neurons in Xenopus laevis oocytes.
| Trivial name | Benzethonium chloride (Standard) |
| Catalog Number | HY-B0942R |
| Research Area | Neurological Disease |
| CAS# | 121-54-0 |
| Purity | ≥98.0% |
| SMILES | CC(C)(C)CC(C1=CC=C(OCCOCC[N+](C)(C)CC2=CC=CC=C2)C=C1)(C)C.[Cl-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/benzethonium-chloride-standard.html |