Dofetilide (Standard) | MedChemExpress (MCE)
Dofetilide (Standard) is the analytical standard of Dofetilide. This product is intended for research and analytical applications. Dofetilide (UK 68789), as a class III antiarrhythmic agent, is an orally active, potent and specific IKr blocker. Dofetilide can be used for the research of cardiovascular disease[1][2].
| Trivial name | Dofetilide (Standard) |
| Catalog Number | HY-B0232R |
| Alternative Name(s) | UK 68789 (Standard) |
| Research Area | Cardiovascular Disease |
| CAS# | 115256-11-6 |
| Purity | ≥98.0% |
| SMILES | CS(=O)(NC1=CC=C(CCN(C)CCOC2=CC=C(NS(=O)(C)=O)C=C2)C=C1)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dofetilide-standard.html |