Valnemulin hydrochloride (Standard) | MedChemExpress (MCE)
Valnemulin (hydrochloride) (Standard) is the analytical standard of Valnemulin (hydrochloride). This product is intended for research and analytical applications. Valnemulin hydrochloride is a pleuromutilin antibiotic which inhibits protein synthesis in bacteria by binding the peptidyl transferase enzyme in the 50s ribosomal subunit.
| Trivial name | Valnemulin hydrochloride (Standard) |
| Catalog Number | HY-B0027R |
| Research Area | Others |
| CAS# | 133868-46-9 |
| Purity | ≥98.0% |
| SMILES | C[C@@H]([C@@H]([C@@](C)(C[C@H]1OC(CSC(C)(C)CNC([C@H](N)C(C)C)=O)=O)C=C)O)C(CCC2=O)(CC[C@H]3C)[C@]2([H])C31C.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/valnemulin-hydrochloride-standard.html |