Valsartan (Standard) | MedChemExpress (MCE)
Valsartan (Standard) is the analytical standard of Valsartan. This product is intended for research and analytical applications. Valsartan (CGP 48933) is an angiotensin II receptor antagonist and has the potential for high blood pressure and heart failure research[1].
| Trivial name | Valsartan (Standard) |
| Catalog Number | HY-18204R |
| Alternative Name(s) | CGP 48933 (Standard) |
| Research Area | Endocrinology; Cardiovascular Disease |
| CAS# | 137862-53-4 |
| Purity | ≥98.0% |
| SMILES | CC(C)[C@@H](C(O)=O)N(C(CCCC)=O)CC1=CC=C(C2=CC=CC=C2C3=NNN=N3)C=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/valsartan-standard.html |