Rocuronium Bromide (Standard) | MedChemExpress (MCE)
Rocuronium (Bromide) (Standard) is the analytical standard of Rocuronium (Bromide). This product is intended for research and analytical applications. Rocuronium Bromide (ORG 9426 Bromide) is an aminosteroid non-depolarizing neuromuscular blocker or muscle relaxant used in modern anaesthesia, to facilitate endotracheal intubation and to provide skeletal musclerelaxation during surgery or mechanical ventilation.
| Trivial name | Rocuronium Bromide (Standard) |
| Catalog Number | HY-17440R |
| Alternative Name(s) | ORG 9426 Bromide (Standard) |
| Research Area | Neurological Disease; Cancer |
| CAS# | 119302-91-9 |
| Purity | ≥98.0% |
| SMILES | C[C@@]12[C@](C[C@H]([N+]3(CC=C)CCCC3)[C@@H]2OC(C)=O)([H])[C@]([C@]4([H])CC1)([H])CC[C@@]([C@]4(C)C5)([H])C[C@H](O)[C@H]5N6CCOCC6.[Br-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/rocuronium-bromide-standard.html |