Posaconazole (Standard) | MedChemExpress (MCE)
Posaconazole (Standard) is the analytical standard of Posaconazole. This product is intended for research and analytical applications. Posaconazole is a broad-spectrum, second generation, triazole compound with antifungal activity.
| Trivial name | Posaconazole (Standard) |
| Catalog Number | HY-17373R |
| Alternative Name(s) | SCH 56592 (Standard) |
| Research Area | Infection; Cancer |
| CAS# | 171228-49-2 |
| Purity | ≥98.0% |
| SMILES | FC1=CC=C([C@@]2(CN3C=NC=N3)C[C@H](COC4=CC=C(N5CCN(C6=CC=C(N7C=NN([C@@H](CC)[C@H](C)O)C7=O)C=C6)CC5)C=C4)CO2)C(F)=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/posaconazole-standard.html |