Zanamivir (Standard) | MedChemExpress (MCE)
Zanamivir (Standard) is the analytical standard of Zanamivir. This product is intended for research and analytical applications. Zanamivir is an influenza viral neuraminidase inhibitor with IC50 values of 0.95 nM and 2.7 nM for influenza A and B, respectively.
| Trivial name | Zanamivir (Standard) |
| Catalog Number | HY-13210R |
| Research Area | Infection |
| CAS# | 139110-80-8 |
| Purity | ≥98.0% |
| SMILES | NC(N[C@@H]1[C@H]([C@@]([H])(OC(C(O)=O)=C1)[C@@H]([C@@H](CO)O)O)NC(C)=O)=N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zanamivir-standard.html |