N-Acetyl-5-hydroxytryptamine (Standard) | MedChemExpress (MCE)
N-Acetyl-5-hydroxytryptamine (Standard) is the analytical standard of N-Acetyl-5-hydroxytryptamine. This product is intended for research and analytical applications. N-Acetyl-5-hydroxytryptamine is a Melatonin precursor, and that it can potently activate TrkB receptor.
| Trivial name | N-Acetyl-5-hydroxytryptamine (Standard) |
| Catalog Number | HY-107854R |
| Alternative Name(s) | N-Acetylserotonin (Standard); Normelatonin (Standard); O-Demethylmelatonin (Standard) |
| Research Area | Neurological Disease |
| CAS# | 1210-83-9 |
| Purity | ≥98.0% |
| SMILES | CC(NCCC1=CNC2=C1C=C(O)C=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n-acetyl-5-hydroxytryptamine-standard.html |