CA/MAO-B-IN-1 | MedChemExpress (MCE)
CA/MAO-B-IN-1 (Compound 78) is a dual inhibitor for human brain carbonic anhydrases (CA) and Monoamine Oxidase-B (MAO-B), with IC50s of 8.8 and 7.0 nM, respectively. CA/MAO-B-IN-1 reveals a human oral absorption of 71.9% through in silico prediction[1].
| Trivial name | CA/MAO-B-IN-1 |
| Catalog Number | HY-163380 |
| Research Area | Neurological Disease |
| Purity | ≥98.0% |
| SMILES | O=S(C1=CC=C(COC2=CC(O3)=C(C=C2)C=C(C)C3=O)C=C1)(N)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ca-mao-b-in-1.html |