Cantharidic acid disodium | MedChemExpress (MCE)
Cantharidic acid disodium is the hydrolysis product of the acid anhydride Cantharidin that induces apoptosis in various human cancer cells. Cantharidic acid disodium is a selective protein phosphatase 2 (PP2A) and PP1 inhibitor withIC50 values of 50 nM and 600 nM, respectively[1][2].
| Trivial name | Cantharidic acid disodium |
| Catalog Number | HY-137135A |
| Research Area | Cancer |
| CAS# | 1465-77-6 |
| Purity | ≥98.0% |
| SMILES | O=C([C@@]([C@@]1(C)C(O[Na])=O)([C@@H]2O[C@H]1CC2)C)O[Na] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cantharidic-acid-disodium.html |