Prostaglandin H2 | MedChemExpress (MCE)
Prostaglandin H2 (PGH2), a potent vasoconstrictor, is produced by the conversion of Arachidonic acid (AA). Prostaglandin H2 is asubstrate for the production of Prostaglandins (PGs) and thromboxanes (TXs)[1].
| Trivial name | Prostaglandin H2 |
| Catalog Number | HY-136500 |
| Alternative Name(s) | PGH2 |
| Research Area | Cardiovascular Disease |
| CAS# | 42935-17-1 |
| Purity | ≥98.0% |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]([C@]2([H])C[C@@]1([H])OO2)C/C=C\CCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/prostaglandin-h2.html |