17-trans Prostaglandin E3 | MedChemExpress (MCE)
17-trans Prostaglandin E3 is a prostaglandin analog, and stimulates Nurr1-dependent transcriptional activity. 17-trans Prostaglandin E3 can be used for research of condition associated with Nurr1,such as cancer and autoimmune disease[1].
| Trivial name | 17-trans Prostaglandin E3 |
| Catalog Number | HY-113481A |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 210979-33-2 |
| Purity | ≥98.0% |
| SMILES | CC/C=C/C[C@H](O)/C=C/[C@@H]1[C@H](C(C[C@H]1O)=O)C/C=C\CCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/17-trans-prostaglandin-e3.html |