rel-Erteberel | MedChemExpress (MCE)
rel-Erteberel is rel isomer of Erteberel (HY-18295). Erteberel is a potent and selective estrogen receptor beta (ERβ) agonist with Ki and EC50 of 1.54 nM and 3.61 nM, respectively. Erteberel has anti-tumor activities[1][2].
| Trivial name | rel-Erteberel |
| Catalog Number | HY-18295A |
| Alternative Name(s) | rel-LY500307 |
| Research Area | Neurological Disease |
| CAS# | 533883-77-1 |
| Purity | ≥98.0% |
| SMILES | OC1=CC=C2O[C@H](C3=CC=C(C=C3)O)[C@@](CCC4)([H])[C@@]4([H])C2=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/rel-erteberel.html |