Termitomycamide B | MedChemExpress (MCE)
Termitomycamide B (compound 2) is a neuroprotective agent that can be obtained from Termitomyces titanicus. Termitomycamide B effectively inhibits endoplasmic reticulum stress-dependent cell death. Termitomycamide B can be used in the study of neurodegenerative diseases[1][2].

Trivial name | Termitomycamide B |
Catalog Number | HY-125603 |
Research Area | Neurological Disease |
CAS# | 1254277-89-8 |
Purity | ≥98.0% |
SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(NCC(C(N1)=CC2=C1C=CC=C2)=O)=O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/termitomycamide-b.html |