Obscurolide A1 | MedChemExpress (MCE)
Obscurolide A1 is a Phosphodiesterase (PDE) inhibitor (IC50=8 mM) that can be obtained from Streptomyces viridochromogenes culture. Obscurolide A1 has the potential to study neurological and inflammatory diseases[1].
| Trivial name | Obscurolide A1 |
| Catalog Number | HY-125738 |
| Research Area | Neurological Disease; Inflammation/Immunology |
| CAS# | 144397-99-9 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC=C(C=C1)NC(C(O2)/C=C/C(C)O)CC2=O)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/obscurolide-a1.html |