Tubulysin B | MedChemExpress (MCE)
Tubulysin B is a highly cytotoxic peptide and potent microtubule destabilizing agents isolated from the myxobacteria Archangium geophyra and Angiococcus disciformis. Tubulysin B has IC50 values in the picomolar range against many cancer cell lines, including those with multidrug resistant properties[1].Tubulysin B is a cytotoxic activity tubulysin which inhibits tubulin polymerization and leads to cell cycle arrest and apoptosis[2].

Trivial name | Tubulysin B |
Catalog Number | HY-N1243 |
Research Area | Cancer |
CAS# | 205304-87-6 |
Purity | ≥98.0% |
SMILES | CC(O[C@@H](C1=NC(C(N[C@H](C[C@H](C)C(O)=O)CC2=CC=C(O)C=C2)=O)=CS1)C[C@H](C(C)C)N(COC(CCC)=O)C([C@@]([C@@H](C)CC)([H])NC([C@@H](CCCC3)N3C)=O)=O)=O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/tubulysin-b.html |