H3B-8800 | MedChemExpress (MCE)
H3B-8800 is a potent and orally active SF3B splicing modulator. H3B-8800 direct interaction with the SF3b complex and shows anti-cancer activity. H3B-8800 has the potential for the research of acute myeloid leukemia (AML) with SF3B1 mutant[1].
| Trivial name | H3B-8800 |
| Catalog Number | HY-111517 |
| Research Area | Cancer |
| CAS# | 1825302-42-8 |
| Purity | ≥98.0% |
| SMILES | O=C(N1CCN(C)CC1)O[C@H]([C@](C)(O)CC[C@@H](O)C2)/C=C/[C@H](C)[C@H](OC2=O)/C(C)=C/C=C/[C@@H](C)C3=NC=CC=C3 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/H3B-8800.html |