Ocifisertib fumarate | MedChemExpress (MCE)
CFI-400945 fumarate is a potent, selective and orally bioavailable PLK4 inhibitor with a Ki and an IC50 of 0.26 nM and 2.8 nM, respectively.
| Trivial name | Ocifisertib fumarate |
| Catalog Number | HY-12300B |
| Alternative Name(s) | CFI-400945 fumarate |
| CAS# | 1616420-30-4 |
| Purity | 99.4% |
| SMILES | OC(/C=C/C(O)=O)=O.O=C1[C@@]2(C3=CC(OC)=CC=C3N1)[C@H](C4=CC=C(C(/C=C/C5=CC=C(C=C5)CN6C[C@H](O[C@H](C6)C)C)=NN7)C7=C4)C2 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/cc_fumarate_.html |
