Exicorilant | MedChemExpress (MCE)
Exicorilant (CORT 125281) is a selective and oral active glucocorticoid receptor (GR) antagonist, with a Ki value of 7 nM[1]. Exicorilant (CORT 125281) has potential to overcome adiposity, glucose intolerance and dyslipidaemia[2].
| Trivial name | Exicorilant |
| Catalog Number | HY-117880 |
| Alternative Name(s) | CORT 125281 |
| Research Area | Metabolic Disease; Endocrinology |
| CAS# | 1781244-77-6 |
| Purity | 98.3% |
| SMILES | O=C([C@]12CC3=C(N(C4=CC=C(F)C=C4)N=C3)C[C@]1([H])CCN(S(=O)(C5=NN(C)N=C5)=O)C2)C6=NC=CC(C(F)(F)F)=C6 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/exicorilant.html |