Evobrutinib | MedChemExpress (MCE)
Evobrutinib (M2951) is an orally active, potent, highly selective and irreversibly covalent BTK inhibitor, with an IC50 of 8.9 nM. Evobrutinib (M2951) can be used for the research of autoimmune diseases[1].
| Trivial name | Evobrutinib |
| Catalog Number | HY-101215 |
| Alternative Name(s) | M2951; MSC2364447C |
| CAS# | 1415823-73-2 |
| Purity | 98.6% |
| SMILES | C=CC(N1CCC(CNC2=NC=NC(N)=C2C3=CC=C(OC4=CC=CC=C4)C=C3)CC1)=O |
| Size | 10 mM * 1 mL |
| Supplier Page | https://www.medchemexpress.com/Evobrutinib.html |