CSF1R-IN-21 | MedChemExpress (MCE)
CSF1R-IN-21 (compound 7e) is a CSF-1R Inhibitor with an IC50 value of 31 nM. CSF1R-IN-21 inhibits CSF-1R auto-phosphorylation and can be used for the research of neurodegenerative diseases [1].
| Trivial name | CSF1R-IN-21 |
| Catalog Number | HY-157996 |
| Research Area | Neurological Disease |
| CAS# | 2935479-62-0 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=NOC(C)=C1)NC2=CC(NC(C3=CC(C(F)(F)F)=CC(N4C(C)=CN=C4)=C3)=O)=CC=C2C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/csf1r-in-21.html |