Stemregenin 1 hydrochloride | MedChemExpress (MCE)
Stemregenin 1 hydrochloride is a purine derivative that antagonizes aryl hydrocarbon receptor signaling in CD34+ cells. IC50 The value is 127 nM. Stemregenin 1 hydrochloride can be used to expand the pluripotency of hematopoietic stem cells (HSC) in stem cell studies[1].
| Trivial name | Stemregenin 1 hydrochloride |
| Catalog Number | HY-15001A |
| Alternative Name(s) | SR1 hydrochloride |
| Research Area | Others |
| CAS# | 2319882-01-2 |
| Purity | ≥98.0% |
| SMILES | CC(C)N1C2=NC(C3=CSC4=C3C=CC=C4)=NC(NCCC5=CC=C(O)C=C5)=C2N=C1.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/stemregenin-1-hydrochloride.html |